C33H29BrIN3O5 — CID 126405629
N-[(E)-[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126405629) has the molecular formula C33H29BrIN3O5 and a molecular weight of 754.42 g/mol. Its IUPAC name is N-[(E)-[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126405629 |
| Molecular Formula | C33H29BrIN3O5 |
| Molecular Weight | 754.42 g/mol |
| Exact Mass | 753.03 |
| IUPAC Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(I)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C33H29BrIN3O5/c1-21-4-5-22(2)38(21)26-10-12-27(13-11-26)41-20-28-14-15-30(43-28)33(39)37-36-18-24-16-29(35)32(31(17-24)40-3)42-19-23-6-8-25(34)9-7-23/h4-18H,19-20H2,1-3H3,(H,37,39)/b36-18+ |
| InChIKey | GJLAPVDKDOEUSR-IZYHBKOJSA-N |
| XLogP | 7.98 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.42 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|