C33H28Br2ClN3O5 — CID 126407440
N-[(E)-[3-chloro-4-[(2,4-dibromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126407440) has the molecular formula C33H28Br2ClN3O5 and a molecular weight of 741.86 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(2,4-dibromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-chloro-4-[(2,4-dibromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126407440 |
| Molecular Formula | C33H28Br2ClN3O5 |
| Molecular Weight | 741.86 g/mol |
| Exact Mass | 739.01 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(2,4-dibromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(Cl)c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C33H28Br2ClN3O5/c1-20-4-5-21(2)39(20)25-8-10-26(11-9-25)42-19-27-12-13-30(44-27)33(40)38-37-17-22-14-29(36)32(31(15-22)41-3)43-18-23-6-7-24(34)16-28(23)35/h4-17H,18-19H2,1-3H3,(H,38,40)/b37-17+ |
| InChIKey | XVNFGWXAXOYTMO-YSYOEVFLSA-N |
| XLogP | 8.80 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.86 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|