C32H25Br2Cl2N3O4 — CID 126405374
N-[(E)-[3,5-dichloro-4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126405374) has the molecular formula C32H25Br2Cl2N3O4 and a molecular weight of 746.28 g/mol. Its IUPAC name is N-[(E)-[3,5-dichloro-4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3,5-dichloro-4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126405374 |
| Molecular Formula | C32H25Br2Cl2N3O4 |
| Molecular Weight | 746.28 g/mol |
| Exact Mass | 742.96 |
| IUPAC Name | N-[(E)-[3,5-dichloro-4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Cl)c(OCc4ccc(Br)cc4Br)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C32H25Br2Cl2N3O4/c1-19-3-4-20(2)39(19)24-7-9-25(10-8-24)41-18-26-11-12-30(43-26)32(40)38-37-16-21-13-28(35)31(29(36)14-21)42-17-22-5-6-23(33)15-27(22)34/h3-16H,17-18H2,1-2H3,(H,38,40)/b37-16+ |
| InChIKey | FRTMGLTUUCLKRJ-YLYVUXRMSA-N |
| XLogP | 9.44 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.28 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|