C27H22Cl2N4O4 — CID 126406792
N-[(E)-[3,5-dichloro-4-(cyanomethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126406792) has the molecular formula C27H22Cl2N4O4 and a molecular weight of 537.40 g/mol. Its IUPAC name is N-[(E)-[3,5-dichloro-4-(cyanomethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3,5-dichloro-4-(cyanomethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126406792 |
| Molecular Formula | C27H22Cl2N4O4 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | N-[(E)-[3,5-dichloro-4-(cyanomethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Cl)c(OCC#N)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C27H22Cl2N4O4/c1-17-3-4-18(2)33(17)20-5-7-21(8-6-20)36-16-22-9-10-25(37-22)27(34)32-31-15-19-13-23(28)26(24(29)14-19)35-12-11-30/h3-10,13-15H,12,16H2,1-2H3,(H,32,34)/b31-15+ |
| InChIKey | JPXSYNVRFXQNHK-IBBHUPRXSA-N |
| XLogP | 6.24 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|