C29H27ClN4O5 — CID 126410390
N-[(E)-[3-chloro-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126410390) has the molecular formula C29H27ClN4O5 and a molecular weight of 547.01 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-chloro-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126410390 |
| Molecular Formula | C29H27ClN4O5 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | N-[(E)-[3-chloro-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(Cl)c1OCC#N |
| InChI | InChI=1S/C29H27ClN4O5/c1-4-36-27-16-21(15-25(30)28(27)37-14-13-31)17-32-33-29(35)26-12-11-24(39-26)18-38-23-9-7-22(8-10-23)34-19(2)5-6-20(34)3/h5-12,15-17H,4,14,18H2,1-3H3,(H,33,35)/b32-17+ |
| InChIKey | VNDIDBIWBKDTJD-VTNSRFBWSA-N |
| XLogP | 5.98 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|