C29H28BrN3O6 — CID 126406879
[2-bromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenyl] acetate (PubChem CID 126406879) has the molecular formula C29H28BrN3O6 and a molecular weight of 594.46 g/mol. Its IUPAC name is [2-bromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenyl] acetate.
| Compound Name | [2-bromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenyl] acetate |
|---|---|
| PubChem CID | 126406879 |
| Molecular Formula | C29H28BrN3O6 |
| Molecular Weight | 594.46 g/mol |
| Exact Mass | 593.12 |
| IUPAC Name | [2-bromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenyl] acetate |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C29H28BrN3O6/c1-5-36-27-15-21(14-25(30)28(27)38-20(4)34)16-31-32-29(35)26-13-12-24(39-26)17-37-23-10-8-22(9-11-23)33-18(2)6-7-19(33)3/h6-16H,5,17H2,1-4H3,(H,32,35)/b31-16+ |
| InChIKey | JYJKBPPASWQJAZ-WCMJOSRZSA-N |
| XLogP | 6.12 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|