C34H30Br2ClN3O5 — CID 126410908
N-[(E)-[3-chloro-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126410908) has the molecular formula C34H30Br2ClN3O5 and a molecular weight of 755.89 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-chloro-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126410908 |
| Molecular Formula | C34H30Br2ClN3O5 |
| Molecular Weight | 755.89 g/mol |
| Exact Mass | 753.02 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(2,4-dibromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(Cl)c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C34H30Br2ClN3O5/c1-4-42-32-16-23(15-30(37)33(32)44-19-24-7-8-25(35)17-29(24)36)18-38-39-34(41)31-14-13-28(45-31)20-43-27-11-9-26(10-12-27)40-21(2)5-6-22(40)3/h5-18H,4,19-20H2,1-3H3,(H,39,41)/b38-18+ |
| InChIKey | WXPVCTMDBUINMY-CDLBOOTPSA-N |
| XLogP | 9.19 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.89 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|