C34H30Br2N4O7 — CID 126406574
N-[(E)-[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126406574) has the molecular formula C34H30Br2N4O7 and a molecular weight of 766.44 g/mol. Its IUPAC name is N-[(E)-[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126406574 |
| Molecular Formula | C34H30Br2N4O7 |
| Molecular Weight | 766.44 g/mol |
| Exact Mass | 764.05 |
| IUPAC Name | N-[(E)-[4-[(2,4-dibromophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc([N+](=O)[O-])c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C34H30Br2N4O7/c1-4-44-32-16-23(15-30(40(42)43)33(32)46-19-24-7-8-25(35)17-29(24)36)18-37-38-34(41)31-14-13-28(47-31)20-45-27-11-9-26(10-12-27)39-21(2)5-6-22(39)3/h5-18H,4,19-20H2,1-3H3,(H,38,41)/b37-18+ |
| InChIKey | IZFWGMFHICXWKY-RQRWGXNHSA-N |
| XLogP | 8.44 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.44 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|