C36H35N5O8 — CID 126406915
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]-5-nitrophenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126406915) has the molecular formula C36H35N5O8 and a molecular weight of 665.70 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]-5-nitrophenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]-5-nitrophenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126406915 |
| Molecular Formula | C36H35N5O8 |
| Molecular Weight | 665.70 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]-5-nitrophenyl]methylideneamino]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc([N+](=O)[O-])c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C36H35N5O8/c1-5-46-33-19-26(18-31(41(44)45)35(33)48-22-34(42)38-27-10-6-23(2)7-11-27)20-37-39-36(43)32-17-16-30(49-32)21-47-29-14-12-28(13-15-29)40-24(3)8-9-25(40)4/h6-20H,5,21-22H2,1-4H3,(H,38,42)(H,39,43)/b37-20+ |
| InChIKey | KCMUGDHWHSZQPJ-HASSKWOGSA-N |
| XLogP | 6.66 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.70 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|