C38H37FN4O6 — CID 126404966
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-prop-2-enylphenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126404966) has the molecular formula C38H37FN4O6 and a molecular weight of 664.73 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-prop-2-enylphenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-prop-2-enylphenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126404966 |
| Molecular Formula | C38H37FN4O6 |
| Molecular Weight | 664.73 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-prop-2-enylphenyl]methylideneamino]furan-2-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(OCC)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C38H37FN4O6/c1-5-7-28-20-27(21-35(46-6-2)37(28)48-24-36(44)41-30-12-10-29(39)11-13-30)22-40-42-38(45)34-19-18-33(49-34)23-47-32-16-14-31(15-17-32)43-25(3)8-9-26(43)4/h5,8-22H,1,6-7,23-24H2,2-4H3,(H,41,44)(H,42,45)/b40-22+ |
| InChIKey | DAEJRBQGZBJRJY-KEGTUQKMSA-N |
| XLogP | 7.31 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.73 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|