C32H34N4O6 — CID 126408702
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126408702) has the molecular formula C32H34N4O6 and a molecular weight of 570.65 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126408702 |
| Molecular Formula | C32H34N4O6 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(OCC)c1OCC(N)=O |
| InChI | InChI=1S/C32H34N4O6/c1-5-7-24-16-23(17-29(39-6-2)31(24)41-20-30(33)37)18-34-35-32(38)28-15-14-27(42-28)19-40-26-12-10-25(11-13-26)36-21(3)8-9-22(36)4/h5,8-18H,1,6-7,19-20H2,2-4H3,(H2,33,37)(H,35,38)/b34-18+ |
| InChIKey | PMKUWSUYGWIPMX-FABQOPTDSA-N |
| XLogP | 5.02 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|