C35H33IN4O6 — CID 126409710
N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126409710) has the molecular formula C35H33IN4O6 and a molecular weight of 732.57 g/mol. Its IUPAC name is N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126409710 |
| Molecular Formula | C35H33IN4O6 |
| Molecular Weight | 732.57 g/mol |
| Exact Mass | 732.14 |
| IUPAC Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C35H33IN4O6/c1-4-43-32-19-25(18-30(36)34(32)45-22-33(41)38-26-8-6-5-7-9-26)20-37-39-35(42)31-17-16-29(46-31)21-44-28-14-12-27(13-15-28)40-23(2)10-11-24(40)3/h5-20H,4,21-22H2,1-3H3,(H,38,41)(H,39,42)/b37-20+ |
| InChIKey | SOEWQCCYDJRKQL-HASSKWOGSA-N |
| XLogP | 7.05 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|