C35H32IN3O7 — CID 126407143
N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126407143) has the molecular formula C35H32IN3O7 and a molecular weight of 733.56 g/mol. Its IUPAC name is N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126407143 |
| Molecular Formula | C35H32IN3O7 |
| Molecular Weight | 733.56 g/mol |
| Exact Mass | 733.13 |
| IUPAC Name | N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cc(I)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H32IN3O7/c1-4-41-33-17-25(15-29(36)34(33)43-19-24-7-13-30-32(16-24)45-21-44-30)18-37-38-35(40)31-14-12-28(46-31)20-42-27-10-8-26(9-11-27)39-22(2)5-6-23(39)3/h5-18H,4,19-21H2,1-3H3,(H,38,40)/b37-18+ |
| InChIKey | KJVZDWXKLFSGOF-RQRWGXNHSA-N |
| XLogP | 7.34 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|