C33H29N3O6 — CID 126408718
N-[(E)-[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126408718) has the molecular formula C33H29N3O6 and a molecular weight of 563.61 g/mol. Its IUPAC name is N-[(E)-[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126408718 |
| Molecular Formula | C33H29N3O6 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-[(E)-[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cccc(OCc4ccc5c(c4)OCO5)c3)o2)cc1 |
| InChI | InChI=1S/C33H29N3O6/c1-22-6-7-23(2)36(22)26-9-11-27(12-10-26)39-20-29-13-15-31(42-29)33(37)35-34-18-24-4-3-5-28(16-24)38-19-25-8-14-30-32(17-25)41-21-40-30/h3-18H,19-21H2,1-2H3,(H,35,37)/b34-18+ |
| InChIKey | PNOSMFXGVXBERU-FABQOPTDSA-N |
| XLogP | 6.34 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|