C32H28N4O6 — CID 126410595
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126410595) has the molecular formula C32H28N4O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126410595 |
| Molecular Formula | C32H28N4O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cccc(OCc4ccc([N+](=O)[O-])cc4)c3)o2)cc1 |
| InChI | InChI=1S/C32H28N4O6/c1-22-6-7-23(2)35(22)26-12-14-28(15-13-26)41-21-30-16-17-31(42-30)32(37)34-33-19-25-4-3-5-29(18-25)40-20-24-8-10-27(11-9-24)36(38)39/h3-19H,20-21H2,1-2H3,(H,34,37)/b33-19+ |
| InChIKey | WDNIDJRVNFEPFI-HNSNBQBZSA-N |
| XLogP | 6.52 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|