C28H28N4O6 — CID 126404428
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(5-nitro-2-propan-2-yloxyphenyl)methylideneamino]furan-2-carboxamide (PubChem CID 126404428) has the molecular formula C28H28N4O6 and a molecular weight of 516.55 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(5-nitro-2-propan-2-yloxyphenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(5-nitro-2-propan-2-yloxyphenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126404428 |
| Molecular Formula | C28H28N4O6 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-(5-nitro-2-propan-2-yloxyphenyl)methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc([N+](=O)[O-])ccc3OC(C)C)o2)cc1 |
| InChI | InChI=1S/C28H28N4O6/c1-18(2)37-26-13-9-23(32(34)35)15-21(26)16-29-30-28(33)27-14-12-25(38-27)17-36-24-10-7-22(8-11-24)31-19(3)5-6-20(31)4/h5-16,18H,17H2,1-4H3,(H,30,33)/b29-16+ |
| InChIKey | ADCBOKIUUYSZOO-MUFRIFMGSA-N |
| XLogP | 5.73 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|