C27H24N4O7 — CID 126411037
[2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenyl] acetate (PubChem CID 126411037) has the molecular formula C27H24N4O7 and a molecular weight of 516.51 g/mol. Its IUPAC name is [2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenyl] acetate.
| Compound Name | [2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenyl] acetate |
|---|---|
| PubChem CID | 126411037 |
| Molecular Formula | C27H24N4O7 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1c(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H24N4O7/c1-17-7-8-18(2)30(17)21-9-11-22(12-10-21)36-16-23-13-14-25(38-23)27(33)29-28-15-20-5-4-6-24(31(34)35)26(20)37-19(3)32/h4-15H,16H2,1-3H3,(H,29,33)/b28-15+ |
| InChIKey | XIFSOJUKPOBCJM-RWPZCVJISA-N |
| XLogP | 4.86 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|