C27H23N5O6 — CID 126406888
N-[(E)-[2-(cyanomethoxy)-3-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126406888) has the molecular formula C27H23N5O6 and a molecular weight of 513.51 g/mol. Its IUPAC name is N-[(E)-[2-(cyanomethoxy)-3-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[2-(cyanomethoxy)-3-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126406888 |
| Molecular Formula | C27H23N5O6 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-[(E)-[2-(cyanomethoxy)-3-nitrophenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cccc([N+](=O)[O-])c3OCC#N)o2)cc1 |
| InChI | InChI=1S/C27H23N5O6/c1-18-6-7-19(2)31(18)21-8-10-22(11-9-21)37-17-23-12-13-25(38-23)27(33)30-29-16-20-4-3-5-24(32(34)35)26(20)36-15-14-28/h3-13,16H,15,17H2,1-2H3,(H,30,33)/b29-16+ |
| InChIKey | JZMCPUYUTROZOB-MUFRIFMGSA-N |
| XLogP | 4.84 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|