C36H30N4O6 — CID 126405523
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[2-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylideneamino]furan-2-carboxamide (PubChem CID 126405523) has the molecular formula C36H30N4O6 and a molecular weight of 614.66 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[2-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[2-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126405523 |
| Molecular Formula | C36H30N4O6 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[2-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cccc([N+](=O)[O-])c3OCc3cccc4ccccc34)o2)cc1 |
| InChI | InChI=1S/C36H30N4O6/c1-24-13-14-25(2)39(24)29-15-17-30(18-16-29)44-23-31-19-20-34(46-31)36(41)38-37-21-27-9-6-12-33(40(42)43)35(27)45-22-28-10-5-8-26-7-3-4-11-32(26)28/h3-21H,22-23H2,1-2H3,(H,38,41)/b37-21+ |
| InChIKey | FVNRVGMRUGFWBP-FDALDRLYSA-N |
| XLogP | 7.67 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|