C32H25ClN4O7 — CID 126414067
[2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenyl] 4-chlorobenzoate (PubChem CID 126414067) has the molecular formula C32H25ClN4O7 and a molecular weight of 613.03 g/mol. Its IUPAC name is [2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenyl] 4-chlorobenzoate.
| Compound Name | [2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126414067 |
| Molecular Formula | C32H25ClN4O7 |
| Molecular Weight | 613.03 g/mol |
| Exact Mass | 612.14 |
| IUPAC Name | [2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenyl] 4-chlorobenzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cccc([N+](=O)[O-])c3OC(=O)c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C32H25ClN4O7/c1-20-6-7-21(2)36(20)25-12-14-26(15-13-25)42-19-27-16-17-29(43-27)31(38)35-34-18-23-4-3-5-28(37(40)41)30(23)44-32(39)22-8-10-24(33)11-9-22/h3-18H,19H2,1-2H3,(H,35,38)/b34-18+ |
| InChIKey | QMIKTENMNPDXLD-FABQOPTDSA-N |
| XLogP | 6.81 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.03 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|