C32H26BrClN4O6 — CID 126408768
N-[(E)-[3-bromo-5-chloro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126408768) has the molecular formula C32H26BrClN4O6 and a molecular weight of 677.94 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-chloro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-bromo-5-chloro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126408768 |
| Molecular Formula | C32H26BrClN4O6 |
| Molecular Weight | 677.94 g/mol |
| Exact Mass | 676.07 |
| IUPAC Name | N-[(E)-[3-bromo-5-chloro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Cl)cc(Br)c3OCc3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C32H26BrClN4O6/c1-20-6-7-21(2)37(20)25-8-10-27(11-9-25)42-19-28-12-13-30(44-28)32(39)36-35-17-23-15-24(34)16-29(33)31(23)43-18-22-4-3-5-26(14-22)38(40)41/h3-17H,18-19H2,1-2H3,(H,36,39)/b35-17+ |
| InChIKey | PSEUXLJHJCYXCI-XJECJHNESA-N |
| XLogP | 7.93 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.94 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|