C30H29BrClN3O6 — CID 126411271
ethyl (2R)-2-[2-bromo-4-chloro-6-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]propanoate (PubChem CID 126411271) has the molecular formula C30H29BrClN3O6 and a molecular weight of 642.93 g/mol. Its IUPAC name is ethyl (2R)-2-[2-bromo-4-chloro-6-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[2-bromo-4-chloro-6-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 126411271 |
| Molecular Formula | C30H29BrClN3O6 |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 641.09 |
| IUPAC Name | ethyl (2R)-2-[2-bromo-4-chloro-6-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1c(Br)cc(Cl)cc1/C=N/NC(=O)c1ccc(COc2ccc(-n3c(C)ccc3C)cc2)o1 |
| InChI | InChI=1S/C30H29BrClN3O6/c1-5-38-30(37)20(4)40-28-21(14-22(32)15-26(28)31)16-33-34-29(36)27-13-12-25(41-27)17-39-24-10-8-23(9-11-24)35-18(2)6-7-19(35)3/h6-16,20H,5,17H2,1-4H3,(H,34,36)/b33-16+/t20-/m1/s1 |
| InChIKey | DIYGVJHUHZFJQG-KNJOJERSSA-N |
| XLogP | 6.78 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|