C29H28BrN3O7 — CID 126410406
(2R)-2-[4-bromo-2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenoxy]propanoic acid (PubChem CID 126410406) has the molecular formula C29H28BrN3O7 and a molecular weight of 610.46 g/mol. Its IUPAC name is (2R)-2-[4-bromo-2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-bromo-2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126410406 |
| Molecular Formula | C29H28BrN3O7 |
| Molecular Weight | 610.46 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | (2R)-2-[4-bromo-2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(Br)cc(C=NNC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C29H28BrN3O7/c1-17-5-6-18(2)33(17)22-7-9-23(10-8-22)38-16-24-11-12-25(40-24)28(34)32-31-15-20-13-21(30)14-26(37-4)27(20)39-19(3)29(35)36/h5-15,19H,16H2,1-4H3,(H,32,34)(H,35,36)/t19-/m1/s1 |
| InChIKey | VPPOOWTZJRPSOH-LJQANCHMSA-N |
| XLogP | 5.65 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|