C27H23BrN4O4 — CID 126406392
N-[(E)-[5-bromo-2-(cyanomethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126406392) has the molecular formula C27H23BrN4O4 and a molecular weight of 547.41 g/mol. Its IUPAC name is N-[(E)-[5-bromo-2-(cyanomethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[5-bromo-2-(cyanomethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126406392 |
| Molecular Formula | C27H23BrN4O4 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | N-[(E)-[5-bromo-2-(cyanomethoxy)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Br)ccc3OCC#N)o2)cc1 |
| InChI | InChI=1S/C27H23BrN4O4/c1-18-3-4-19(2)32(18)22-6-8-23(9-7-22)35-17-24-10-12-26(36-24)27(33)31-30-16-20-15-21(28)5-11-25(20)34-14-13-29/h3-12,15-16H,14,17H2,1-2H3,(H,31,33)/b30-16+ |
| InChIKey | IMTWXBHMFMOZNK-OKCVXOCRSA-N |
| XLogP | 5.69 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|