C30H24BrN3O6 — CID 126412158
[4-bromo-2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126412158) has the molecular formula C30H24BrN3O6 and a molecular weight of 602.44 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-bromo-2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126412158 |
| Molecular Formula | C30H24BrN3O6 |
| Molecular Weight | 602.44 g/mol |
| Exact Mass | 601.08 |
| IUPAC Name | [4-bromo-2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C\c3cc(Br)ccc3OC(=O)c3ccco3)o2)cc1 |
| InChI | InChI=1S/C30H24BrN3O6/c1-19-5-6-20(2)34(19)23-8-10-24(11-9-23)38-18-25-12-14-27(39-25)29(35)33-32-17-21-16-22(31)7-13-26(21)40-30(36)28-4-3-15-37-28/h3-17H,18H2,1-2H3,(H,33,35)/b32-17- |
| InChIKey | HLXSLWUMSYLMEV-KYHGBAKBSA-N |
| XLogP | 6.60 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.44 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|