C30H25N3O6 — CID 126414943
[2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126414943) has the molecular formula C30H25N3O6 and a molecular weight of 523.55 g/mol. Its IUPAC name is [2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126414943 |
| Molecular Formula | C30H25N3O6 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | [2-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C\c3ccccc3OC(=O)c3ccco3)o2)cc1 |
| InChI | InChI=1S/C30H25N3O6/c1-20-9-10-21(2)33(20)23-11-13-24(14-12-23)37-19-25-15-16-27(38-25)29(34)32-31-18-22-6-3-4-7-26(22)39-30(35)28-8-5-17-36-28/h3-18H,19H2,1-2H3,(H,32,34)/b31-18- |
| InChIKey | YFJCIDGTCTVLGY-MNBJERMJSA-N |
| XLogP | 5.84 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|