C28H27N3O7 — CID 126404689
2-[2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126404689) has the molecular formula C28H27N3O7 and a molecular weight of 517.54 g/mol. Its IUPAC name is 2-[2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126404689 |
| Molecular Formula | C28H27N3O7 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 2-[2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cccc(C=NNC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c1OCC(=O)O |
| InChI | InChI=1S/C28H27N3O7/c1-18-7-8-19(2)31(18)21-9-11-22(12-10-21)36-16-23-13-14-25(38-23)28(34)30-29-15-20-5-4-6-24(35-3)27(20)37-17-26(32)33/h4-15H,16-17H2,1-3H3,(H,30,34)(H,32,33) |
| InChIKey | BQLODBHXZQEYLJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|