C34H31N3O7 — CID 126405988
N-[[2-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126405988) has the molecular formula C34H31N3O7 and a molecular weight of 593.64 g/mol. Its IUPAC name is N-[[2-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[[2-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126405988 |
| Molecular Formula | C34H31N3O7 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | N-[[2-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | COc1cccc(C=NNC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C34H31N3O7/c1-22-7-8-23(2)37(22)26-10-12-27(13-11-26)40-20-28-14-16-31(44-28)34(38)36-35-18-25-5-4-6-30(39-3)33(25)41-19-24-9-15-29-32(17-24)43-21-42-29/h4-18H,19-21H2,1-3H3,(H,36,38) |
| InChIKey | HCVVNUFWECCQKP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|