C33H25Br2N3O7 — CID 126414028
[2,4-dibromo-6-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126414028) has the molecular formula C33H25Br2N3O7 and a molecular weight of 735.38 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2,4-dibromo-6-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126414028 |
| Molecular Formula | C33H25Br2N3O7 |
| Molecular Weight | 735.38 g/mol |
| Exact Mass | 733.01 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C\c3cc(Br)cc(Br)c3OC(=O)c3ccc4c(c3)OCO4)o2)cc1 |
| InChI | InChI=1S/C33H25Br2N3O7/c1-19-3-4-20(2)38(19)24-6-8-25(9-7-24)41-17-26-10-12-29(44-26)32(39)37-36-16-22-13-23(34)15-27(35)31(22)45-33(40)21-5-11-28-30(14-21)43-18-42-28/h3-16H,17-18H2,1-2H3,(H,37,39)/b36-16- |
| InChIKey | PXKBCWFUNRLXPX-HTVDVWKISA-N |
| XLogP | 7.50 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.38 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|