C24H17Br3N2O7 — CID 2833211
[2,4-dibromo-6-[[[2-(2-bromo-4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 2833211) has the molecular formula C24H17Br3N2O7 and a molecular weight of 685.12 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[2-(2-bromo-4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2,4-dibromo-6-[[[2-(2-bromo-4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 2833211 |
| Molecular Formula | C24H17Br3N2O7 |
| Molecular Weight | 685.12 g/mol |
| Exact Mass | 681.86 |
| IUPAC Name | [2,4-dibromo-6-[[[2-(2-bromo-4-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1ccc(OCC(=O)NN=Cc2cc(Br)cc(Br)c2OC(=O)c2ccc3c(c2)OCO3)c(Br)c1 |
| InChI | InChI=1S/C24H17Br3N2O7/c1-32-16-3-5-19(17(26)9-16)33-11-22(30)29-28-10-14-6-15(25)8-18(27)23(14)36-24(31)13-2-4-20-21(7-13)35-12-34-20/h2-10H,11-12H2,1H3,(H,29,30) |
| InChIKey | GMADGVXMRVLFJI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.12 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|