C27H23Br2N3O9 — CID 6078387
[2,4-dibromo-6-[(Z)-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 6078387) has the molecular formula C27H23Br2N3O9 and a molecular weight of 693.30 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2,4-dibromo-6-[(Z)-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 6078387 |
| Molecular Formula | C27H23Br2N3O9 |
| Molecular Weight | 693.30 g/mol |
| Exact Mass | 690.98 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[[2-[(3,4,5-trimethoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1cc(C(=O)NCC(=O)N/N=C\c2cc(Br)cc(Br)c2OC(=O)c2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C27H23Br2N3O9/c1-36-21-8-15(9-22(37-2)25(21)38-3)26(34)30-12-23(33)32-31-11-16-6-17(28)10-18(29)24(16)41-27(35)14-4-5-19-20(7-14)40-13-39-19/h4-11H,12-13H2,1-3H3,(H,30,34)(H,32,33)/b31-11- |
| InChIKey | KHKGDAWWHYGFMT-VWDPFFEDSA-N |
| XLogP | 4.07 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|