C26H22Br2N2O7 — CID 126143780
[2,4-dibromo-6-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126143780) has the molecular formula C26H22Br2N2O7 and a molecular weight of 634.28 g/mol. Its IUPAC name is [2,4-dibromo-6-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2,4-dibromo-6-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126143780 |
| Molecular Formula | C26H22Br2N2O7 |
| Molecular Weight | 634.28 g/mol |
| Exact Mass | 631.98 |
| IUPAC Name | [2,4-dibromo-6-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2ccc3c(c2)COC3)cc(OC)c1OC |
| InChI | InChI=1S/C26H22Br2N2O7/c1-33-21-8-16(9-22(34-2)24(21)35-3)26(32)37-23-17(7-19(27)10-20(23)28)11-29-30-25(31)14-4-5-15-12-36-13-18(15)6-14/h4-11H,12-13H2,1-3H3,(H,30,31) |
| InChIKey | XSNLUWSULNNPND-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.28 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|