C23H15Br2ClN2O4 — CID 126142241
[2,4-dibromo-6-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate (PubChem CID 126142241) has the molecular formula C23H15Br2ClN2O4 and a molecular weight of 578.64 g/mol. Its IUPAC name is [2,4-dibromo-6-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2,4-dibromo-6-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126142241 |
| Molecular Formula | C23H15Br2ClN2O4 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 575.91 |
| IUPAC Name | [2,4-dibromo-6-[(1,3-dihydro-2-benzofuran-5-carbonylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(NN=Cc1cc(Br)cc(Br)c1OC(=O)c1ccc(Cl)cc1)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C23H15Br2ClN2O4/c24-18-8-16(10-27-28-22(29)14-1-2-15-11-31-12-17(15)7-14)21(20(25)9-18)32-23(30)13-3-5-19(26)6-4-13/h1-10H,11-12H2,(H,28,29) |
| InChIKey | WTVLMQCCDYVBCG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|