C30H23Br2N3O4 — CID 126231139
[2,4-dibromo-6-[[[3-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 126231139) has the molecular formula C30H23Br2N3O4 and a molecular weight of 649.34 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[3-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [2,4-dibromo-6-[[[3-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126231139 |
| Molecular Formula | C30H23Br2N3O4 |
| Molecular Weight | 649.34 g/mol |
| Exact Mass | 647.01 |
| IUPAC Name | [2,4-dibromo-6-[[[3-[(3-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2cccc(NC(=O)c3cccc(C)c3)c2)cc1 |
| InChI | InChI=1S/C30H23Br2N3O4/c1-18-9-11-20(12-10-18)30(38)39-27-23(14-24(31)16-26(27)32)17-33-35-29(37)22-7-4-8-25(15-22)34-28(36)21-6-3-5-19(2)13-21/h3-17H,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | ODRKDHVCUDBFIZ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.34 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|