C27H25Br2IN2O7 — CID 3097823
[2,4-dibromo-6-[[[2-(4-iodo-2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3097823) has the molecular formula C27H25Br2IN2O7 and a molecular weight of 776.22 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[2-(4-iodo-2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2,4-dibromo-6-[[[2-(4-iodo-2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3097823 |
| Molecular Formula | C27H25Br2IN2O7 |
| Molecular Weight | 776.22 g/mol |
| Exact Mass | 773.91 |
| IUPAC Name | [2,4-dibromo-6-[[[2-(4-iodo-2,6-dimethylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)COc2c(C)cc(I)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C27H25Br2IN2O7/c1-14-6-19(30)7-15(2)24(14)38-13-23(33)32-31-12-17-8-18(28)11-20(29)25(17)39-27(34)16-9-21(35-3)26(37-5)22(10-16)36-4/h6-12H,13H2,1-5H3,(H,32,33) |
| InChIKey | OAKRDJBNVCNPAB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.22 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|