C20H16BrN3O5 — CID 3678693
N-[2-[2-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3678693) has the molecular formula C20H16BrN3O5 and a molecular weight of 458.27 g/mol. Its IUPAC name is N-[2-[2-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3678693 |
| Molecular Formula | C20H16BrN3O5 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | N-[2-[2-[(5-bromo-2-prop-2-ynoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | C#CCOc1ccc(Br)cc1C=NNC(=O)CNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H16BrN3O5/c1-2-7-27-16-6-4-15(21)8-14(16)10-23-24-19(25)11-22-20(26)13-3-5-17-18(9-13)29-12-28-17/h1,3-6,8-10H,7,11-12H2,(H,22,26)(H,24,25) |
| InChIKey | VZUJAPGBBWCAEN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|