C19H16BrN3O4 — CID 126226134
2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]acetamide (PubChem CID 126226134) has the molecular formula C19H16BrN3O4 and a molecular weight of 430.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126226134 |
| Molecular Formula | C19H16BrN3O4 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]acetamide |
| SMILES | C#CCOc1ccc(Br)cc1/C=N\NC(=O)CNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16BrN3O4/c1-2-7-25-16-5-3-14(20)8-13(16)10-22-23-19(24)11-21-15-4-6-17-18(9-15)27-12-26-17/h1,3-6,8-10,21H,7,11-12H2,(H,23,24)/b22-10- |
| InChIKey | RWVMSEDPQSRCGZ-YVNNLAQVSA-N |
| XLogP | 2.75 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|