C16H12BrN4O6- — CID 7097101
2-[(Z)-[[2-(1,3-benzodioxol-5-ylamino)acetyl]hydrazinylidene]methyl]-4-bromo-6-nitrophenolate (PubChem CID 7097101) has the molecular formula C16H12BrN4O6- and a molecular weight of 436.20 g/mol. Its IUPAC name is 2-[(Z)-[[2-(1,3-benzodioxol-5-ylamino)acetyl]hydrazinylidene]methyl]-4-bromo-6-nitrophenolate.
| Compound Name | 2-[(Z)-[[2-(1,3-benzodioxol-5-ylamino)acetyl]hydrazinylidene]methyl]-4-bromo-6-nitrophenolate |
|---|---|
| PubChem CID | 7097101 |
| Molecular Formula | C16H12BrN4O6- |
| Molecular Weight | 436.20 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 2-[(Z)-[[2-(1,3-benzodioxol-5-ylamino)acetyl]hydrazinylidene]methyl]-4-bromo-6-nitrophenolate |
| SMILES | O=C(CNc1ccc2c(c1)OCO2)N/N=C\c1cc(Br)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C16H13BrN4O6/c17-10-3-9(16(23)12(4-10)21(24)25)6-19-20-15(22)7-18-11-1-2-13-14(5-11)27-8-26-13/h1-6,18,23H,7-8H2,(H,20,22)/p-1/b19-6- |
| InChIKey | QPSJUUHMOPSXMF-SWNXQHNESA-M |
| XLogP | 1.72 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|