C16H11BrN3O6- — CID 7008137
4-bromo-2-[[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate (PubChem CID 7008137) has the molecular formula C16H11BrN3O6- and a molecular weight of 421.18 g/mol. Its IUPAC name is 4-bromo-2-[[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate.
| Compound Name | 4-bromo-2-[[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7008137 |
| Molecular Formula | C16H11BrN3O6- |
| Molecular Weight | 421.18 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | 4-bromo-2-[[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate |
| SMILES | O=C(NN=Cc1cc(Br)cc([N+](=O)[O-])c1[O-])[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H12BrN3O6/c17-10-5-9(15(21)11(6-10)20(23)24)7-18-19-16(22)14-8-25-12-3-1-2-4-13(12)26-14/h1-7,14,21H,8H2,(H,19,22)/p-1/t14-/m1/s1 |
| InChIKey | DKHGABQXORNFBN-CQSZACIVSA-M |
| XLogP | 1.72 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|