C16H12Br2N2O5 — CID 1040202
(3S)-N-[(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 1040202) has the molecular formula C16H12Br2N2O5 and a molecular weight of 472.09 g/mol. Its IUPAC name is (3S)-N-[(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 1040202 |
| Molecular Formula | C16H12Br2N2O5 |
| Molecular Weight | 472.09 g/mol |
| Exact Mass | 469.91 |
| IUPAC Name | (3S)-N-[(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)c(O)c(Br)c1O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H12Br2N2O5/c17-9-5-8(14(21)13(18)15(9)22)6-19-20-16(23)12-7-24-10-3-1-2-4-11(10)25-12/h1-6,12,21-22H,7H2,(H,20,23)/t12-/m0/s1 |
| InChIKey | VDCDUAWYNMSGGZ-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|