C17H15BrN2O5 — CID 9238606
(3S)-N-[(Z)-(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 9238606) has the molecular formula C17H15BrN2O5 and a molecular weight of 407.22 g/mol. Its IUPAC name is (3S)-N-[(Z)-(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 9238606 |
| Molecular Formula | C17H15BrN2O5 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | (3S)-N-[(Z)-(2-bromo-5-hydroxy-4-methoxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | COc1cc(Br)c(/C=N\NC(=O)[C@@H]2COc3ccccc3O2)cc1O |
| InChI | InChI=1S/C17H15BrN2O5/c1-23-15-7-11(18)10(6-12(15)21)8-19-20-17(22)16-9-24-13-4-2-3-5-14(13)25-16/h2-8,16,21H,9H2,1H3,(H,20,22)/b19-8-/t16-/m0/s1 |
| InChIKey | FVQUQESRKVIYDW-ASTMVQESSA-N |
| XLogP | 2.45 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|