C17H14Br2N2O5 — CID 136850014
(3S)-N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 136850014) has the molecular formula C17H14Br2N2O5 and a molecular weight of 486.12 g/mol. Its IUPAC name is (3S)-N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 136850014 |
| Molecular Formula | C17H14Br2N2O5 |
| Molecular Weight | 486.12 g/mol |
| Exact Mass | 483.93 |
| IUPAC Name | (3S)-N-[(Z)-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@@H]2COc3ccccc3O2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C17H14Br2N2O5/c1-24-12-6-9(14(18)15(19)16(12)22)7-20-21-17(23)13-8-25-10-4-2-3-5-11(10)26-13/h2-7,13,22H,8H2,1H3,(H,21,23)/b20-7-/t13-/m0/s1 |
| InChIKey | FXOMEALEIAHAJH-XWVRBGGFSA-N |
| XLogP | 3.22 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|