C17H15BrN2O5 — CID 143326671
N-[(E)-[2-bromo-5-(hydroxymethoxy)phenyl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 143326671) has the molecular formula C17H15BrN2O5 and a molecular weight of 407.22 g/mol. Its IUPAC name is N-[(E)-[2-bromo-5-(hydroxymethoxy)phenyl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[(E)-[2-bromo-5-(hydroxymethoxy)phenyl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 143326671 |
| Molecular Formula | C17H15BrN2O5 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | N-[(E)-[2-bromo-5-(hydroxymethoxy)phenyl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(N/N=C/c1cc(OCO)ccc1Br)C1COc2ccccc2O1 |
| InChI | InChI=1S/C17H15BrN2O5/c18-13-6-5-12(24-10-21)7-11(13)8-19-20-17(22)16-9-23-14-3-1-2-4-15(14)25-16/h1-8,16,21H,9-10H2,(H,20,22)/b19-8+ |
| InChIKey | DTQAJFVQOWZQMX-UFWORHAWSA-N |
| XLogP | 2.07 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|