C14H11BrN2O3S — CID 6061296
N-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 6061296) has the molecular formula C14H11BrN2O3S and a molecular weight of 367.22 g/mol. Its IUPAC name is N-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 6061296 |
| Molecular Formula | C14H11BrN2O3S |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | N-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)cs1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C14H11BrN2O3S/c15-9-5-10(21-8-9)6-16-17-14(18)13-7-19-11-3-1-2-4-12(11)20-13/h1-6,8,13H,7H2,(H,17,18)/b16-6- |
| InChIKey | LWWPCMSMTFJTED-SOFYXZRVSA-N |
| XLogP | 2.80 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|