C18H13BrN2O3S — CID 2866199
N-[(4-bromothiophen-2-yl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide (PubChem CID 2866199) has the molecular formula C18H13BrN2O3S and a molecular weight of 417.28 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 2866199 |
| Molecular Formula | C18H13BrN2O3S |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)cs1)C1COc2cc3ccccc3cc2O1 |
| InChI | InChI=1S/C18H13BrN2O3S/c19-13-7-14(25-10-13)8-20-21-18(22)17-9-23-15-5-11-3-1-2-4-12(11)6-16(15)24-17/h1-8,10,17H,9H2,(H,21,22) |
| InChIKey | QLSOBSCREFZJJT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|