C30H25N3O3 — CID 95180978
(3R)-N-[(Z)-(1-benzyl-2-methylindol-3-yl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide (PubChem CID 95180978) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is (3R)-N-[(Z)-(1-benzyl-2-methylindol-3-yl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide.
| Compound Name | (3R)-N-[(Z)-(1-benzyl-2-methylindol-3-yl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 95180978 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (3R)-N-[(Z)-(1-benzyl-2-methylindol-3-yl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide |
| SMILES | Cc1c(/C=N\NC(=O)[C@H]2COc3cc4ccccc4cc3O2)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C30H25N3O3/c1-20-25(24-13-7-8-14-26(24)33(20)18-21-9-3-2-4-10-21)17-31-32-30(34)29-19-35-27-15-22-11-5-6-12-23(22)16-28(27)36-29/h2-17,29H,18-19H2,1H3,(H,32,34)/b31-17-/t29-/m1/s1 |
| InChIKey | SGKZGCCILHFTOX-UBESYEFQSA-N |
| XLogP | 5.44 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|