C20H14Br2N2O4 — CID 135643712
N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide (PubChem CID 135643712) has the molecular formula C20H14Br2N2O4 and a molecular weight of 506.15 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide.
| Compound Name | N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 135643712 |
| Molecular Formula | C20H14Br2N2O4 |
| Molecular Weight | 506.15 g/mol |
| Exact Mass | 503.93 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)c(O)c(Br)c1)C1COc2cc3ccccc3cc2O1 |
| InChI | InChI=1S/C20H14Br2N2O4/c21-14-5-11(6-15(22)19(14)25)9-23-24-20(26)18-10-27-16-7-12-3-1-2-4-13(12)8-17(16)28-18/h1-9,18,25H,10H2,(H,24,26)/b23-9- |
| InChIKey | BJQBJXSLHHIUJA-AQHIEDMUSA-N |
| XLogP | 4.36 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.15 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|