C26H29N3O3 — CID 39858134
(3S)-N-[(E)-[4-(dipropylamino)phenyl]methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide (PubChem CID 39858134) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is (3S)-N-[(E)-[4-(dipropylamino)phenyl]methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(E)-[4-(dipropylamino)phenyl]methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 39858134 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (3S)-N-[(E)-[4-(dipropylamino)phenyl]methylideneamino]-2,3-dihydrobenzo[g][1,4]benzodioxine-3-carboxamide |
| SMILES | CCCN(CCC)c1ccc(/C=N/NC(=O)[C@@H]2COc3cc4ccccc4cc3O2)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-3-13-29(14-4-2)22-11-9-19(10-12-22)17-27-28-26(30)25-18-31-23-15-20-7-5-6-8-21(20)16-24(23)32-25/h5-12,15-17,25H,3-4,13-14,18H2,1-2H3,(H,28,30)/b27-17+/t25-/m0/s1 |
| InChIKey | OQQPIKJTFYEBIY-YYYGAUAXSA-N |
| XLogP | 4.76 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|