C9H9BrN2OS — CID 42995239
N-[(E)-(4-bromothiophen-2-yl)methylideneamino]cyclopropanecarboxamide (PubChem CID 42995239) has the molecular formula C9H9BrN2OS and a molecular weight of 273.16 g/mol. Its IUPAC name is N-[(E)-(4-bromothiophen-2-yl)methylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(E)-(4-bromothiophen-2-yl)methylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 42995239 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | N-[(E)-(4-bromothiophen-2-yl)methylideneamino]cyclopropanecarboxamide |
| SMILES | O=C(N/N=C/c1cc(Br)cs1)C1CC1 |
| InChI | InChI=1S/C9H9BrN2OS/c10-7-3-8(14-5-7)4-11-12-9(13)6-1-2-6/h3-6H,1-2H2,(H,12,13)/b11-4+ |
| InChIKey | HWFIORFDTWOKQI-NYYWCZLTSA-N |
| XLogP | 2.37 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|