C14H18N2O — CID 6910562
N-[(E)-(2,4,6-trimethylphenyl)methylideneamino]cyclopropanecarboxamide (PubChem CID 6910562) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[(E)-(2,4,6-trimethylphenyl)methylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(E)-(2,4,6-trimethylphenyl)methylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 6910562 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-[(E)-(2,4,6-trimethylphenyl)methylideneamino]cyclopropanecarboxamide |
| SMILES | Cc1cc(C)c(/C=N/NC(=O)C2CC2)c(C)c1 |
| InChI | InChI=1S/C14H18N2O/c1-9-6-10(2)13(11(3)7-9)8-15-16-14(17)12-4-5-12/h6-8,12H,4-5H2,1-3H3,(H,16,17)/b15-8+ |
| InChIKey | FWKZNHDQJAGVBL-OVCLIPMQSA-N |
| XLogP | 2.47 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|